H-GLY-GLY-BETANA HBR
Catalog No: FT-0626790
CAS No: 3313-48-2
- Chemical Name: H-GLY-GLY-BETANA HBR
- Molecular Formula: C14H16BrN3O2
- Molecular Weight: 338.2
- InChI Key: HBILDMMVUMVIMF-UHFFFAOYSA-N
- InChI: InChI=1S/C14H15N3O2.BrH/c15-8-13(18)16-9-14(19)17-12-6-5-10-3-1-2-4-11(10)7-12;/h1-7H,8-9,15H2,(H,16,18)(H,17,19);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 338.20000 |
| Density: | N/A |
| CAS: | 3313-48-2 |
| Bolling_Point: | 621.6ºC at 760mmHg |
| Product_Name: | 2-amino-N-[2-(naphthalen-2-ylamino)-2-oxoethyl]acetamide |
| Melting_Point: | N/A |
| Flash_Point: | 329.7ºC |
| MF: | C14H16BrN3O2 |
| LogP: | 2.97550 |
|---|---|
| Flash_Point: | 329.7ºC |
| FW: | 338.20000 |
| PSA: | 84.22000 |
| MF: | C14H16BrN3O2 |
| Bolling_Point: | 621.6ºC at 760mmHg |
| Exact_Mass: | 337.04300 |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R40 |
| Safety_Statements: | 22-36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P281 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)